C31H44N2O7Si — CID 67604150
tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(4-hydroxybenzoyl)oxyazepane-1-carboxylate (PubChem CID 67604150) has the molecular formula C31H44N2O7Si and a molecular weight of 584.79 g/mol. Its IUPAC name is tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(4-hydroxybenzoyl)oxyazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(4-hydroxybenzoyl)oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 67604150 |
| Molecular Formula | C31H44N2O7Si |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(4-hydroxybenzoyl)oxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)c2ccccc2O[Si](C)(C)C(C)(C)C)(OC(=O)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C31H44N2O7Si/c1-29(2,3)39-28(37)33-20-11-18-31(19-21-33,38-27(36)22-14-16-23(34)17-15-22)32-26(35)24-12-9-10-13-25(24)40-41(7,8)30(4,5)6/h9-10,12-17,34H,11,18-21H2,1-8H3,(H,32,35) |
| InChIKey | XRIUVQCXFQYCNJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|