C43H54N2O8Si — CID 67604072
tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-7-phenylmethoxynaphthalene-2-carbonyl)oxyazepane-1-carboxylate (PubChem CID 67604072) has the molecular formula C43H54N2O8Si and a molecular weight of 755.00 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-7-phenylmethoxynaphthalene-2-carbonyl)oxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-7-phenylmethoxynaphthalene-2-carbonyl)oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 67604072 |
| Molecular Formula | C43H54N2O8Si |
| Molecular Weight | 755.00 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-7-phenylmethoxynaphthalene-2-carbonyl)oxyazepane-1-carboxylate |
| SMILES | COc1cc2ccc(OCc3ccccc3)cc2cc1C(=O)O[C@@]1(O[Si](C)(C)C(C)(C)C)CCCN(C(=O)OC(C)(C)C)C[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C43H54N2O8Si/c1-41(2,3)52-40(48)45-24-16-23-43(53-54(8,9)42(4,5)6,37(28-45)44-38(46)31-19-14-11-15-20-31)51-39(47)35-26-33-25-34(22-21-32(33)27-36(35)49-7)50-29-30-17-12-10-13-18-30/h10-15,17-22,25-27,37H,16,23-24,28-29H2,1-9H3,(H,44,46)/t37-,43-/m1/s1 |
| InChIKey | ZSZBENLKHJNDBY-GJSZZFLHSA-N |
| XLogP | 9.13 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.00 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|