C37H48N2O6Si — CID 67604148
tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-phenylbenzoyl)oxyazepane-1-carboxylate (PubChem CID 67604148) has the molecular formula C37H48N2O6Si and a molecular weight of 644.89 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-phenylbenzoyl)oxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-phenylbenzoyl)oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 67604148 |
| Molecular Formula | C37H48N2O6Si |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | tert-butyl (3R,4R)-3-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-4-(4-phenylbenzoyl)oxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](OC(=O)c2ccc(-c3ccccc3)cc2)(O[Si](C)(C)C(C)(C)C)[C@H](NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C37H48N2O6Si/c1-35(2,3)44-34(42)39-25-15-24-37(45-46(7,8)36(4,5)6,31(26-39)38-32(40)29-18-13-10-14-19-29)43-33(41)30-22-20-28(21-23-30)27-16-11-9-12-17-27/h9-14,16-23,31H,15,24-26H2,1-8H3,(H,38,40)/t31-,37-/m1/s1 |
| InChIKey | AQRFELGKYPUNHS-PRDAIKMNSA-N |
| XLogP | 8.06 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|