C37H48N2O7Si — CID 54284517
tert-butyl (3R,4R)-3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(2-phenoxybenzoyl)oxyazepane-1-carboxylate (PubChem CID 54284517) has the molecular formula C37H48N2O7Si and a molecular weight of 660.88 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(2-phenoxybenzoyl)oxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(2-phenoxybenzoyl)oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 54284517 |
| Molecular Formula | C37H48N2O7Si |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | tert-butyl (3R,4R)-3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-(2-phenoxybenzoyl)oxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](OC(=O)c2ccccc2Oc2ccccc2)[C@H](NC(=O)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C37H48N2O7Si/c1-36(2,3)45-35(42)39-24-14-19-32(44-34(41)29-17-12-13-18-31(29)43-27-15-10-9-11-16-27)30(25-39)38-33(40)26-20-22-28(23-21-26)46-47(7,8)37(4,5)6/h9-13,15-18,20-23,30,32H,14,19,24-25H2,1-8H3,(H,38,40)/t30-,32-/m1/s1 |
| InChIKey | RTDRJYRKJFAUMR-XLJNKUFUSA-N |
| XLogP | 8.22 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|