C29H42N2O5Si — CID 67747525
(3R,4R)-3-[[4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxybenzoyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid (PubChem CID 67747525) has the molecular formula C29H42N2O5Si and a molecular weight of 526.75 g/mol. Its IUPAC name is (3R,4R)-3-[[4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxybenzoyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid.
| Compound Name | (3R,4R)-3-[[4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxybenzoyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 67747525 |
| Molecular Formula | C29H42N2O5Si |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | (3R,4R)-3-[[4-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxybenzoyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid |
| SMILES | CC(C)C(C)(C)[Si](C)(C)Oc1ccc(C(=O)N[C@@H]2CN(C(=O)O)CCC[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H42N2O5Si/c1-21(2)29(3,4)37(5,6)36-24-16-14-23(15-17-24)27(32)30-25-19-31(28(33)34)18-10-13-26(25)35-20-22-11-8-7-9-12-22/h7-9,11-12,14-17,21,25-26H,10,13,18-20H2,1-6H3,(H,30,32)(H,33,34)/t25-,26-/m1/s1 |
| InChIKey | GGRFXMQSNNUMSC-CLJLJLNGSA-N |
| XLogP | 6.16 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|