C27H30N2O6 — CID 54003085
(3R,4R)-3-[[3-(methoxymethoxy)naphthalene-2-carbonyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid (PubChem CID 54003085) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is (3R,4R)-3-[[3-(methoxymethoxy)naphthalene-2-carbonyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid.
| Compound Name | (3R,4R)-3-[[3-(methoxymethoxy)naphthalene-2-carbonyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 54003085 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (3R,4R)-3-[[3-(methoxymethoxy)naphthalene-2-carbonyl]amino]-4-phenylmethoxyazepane-1-carboxylic acid |
| SMILES | COCOc1cc2ccccc2cc1C(=O)N[C@@H]1CN(C(=O)O)CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O6/c1-33-18-35-25-15-21-11-6-5-10-20(21)14-22(25)26(30)28-23-16-29(27(31)32)13-7-12-24(23)34-17-19-8-3-2-4-9-19/h2-6,8-11,14-15,23-24H,7,12-13,16-18H2,1H3,(H,28,30)(H,31,32)/t23-,24-/m1/s1 |
| InChIKey | KMYZFHAPZULBTE-DNQXCXABSA-N |
| XLogP | 4.28 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|