C30H30N2O3 — CID 163338327
2-(4-ethoxyphenyl)-N-[(1R,2R)-2-phenylmethoxycyclopentyl]quinoline-4-carboxamide (PubChem CID 163338327) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[(1R,2R)-2-phenylmethoxycyclopentyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[(1R,2R)-2-phenylmethoxycyclopentyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 163338327 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[(1R,2R)-2-phenylmethoxycyclopentyl]quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)N[C@@H]3CCC[C@H]3OCc3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-2-34-23-17-15-22(16-18-23)28-19-25(24-11-6-7-12-26(24)31-28)30(33)32-27-13-8-14-29(27)35-20-21-9-4-3-5-10-21/h3-7,9-12,15-19,27,29H,2,8,13-14,20H2,1H3,(H,32,33)/t27-,29-/m1/s1 |
| InChIKey | WKVPLUYUKQGIHR-XRKRLSELSA-N |
| XLogP | 6.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |