C18H22N2O5 — CID 3483088
methyl 1-[[2-[2-(methylcarbamoyl)phenyl]-2-oxoacetyl]amino]cyclohexane-1-carboxylate (PubChem CID 3483088) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl 1-[[2-[2-(methylcarbamoyl)phenyl]-2-oxoacetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[2-[2-(methylcarbamoyl)phenyl]-2-oxoacetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3483088 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl 1-[[2-[2-(methylcarbamoyl)phenyl]-2-oxoacetyl]amino]cyclohexane-1-carboxylate |
| SMILES | CNC(=O)c1ccccc1C(=O)C(=O)NC1(C(=O)OC)CCCCC1 |
| InChI | InChI=1S/C18H22N2O5/c1-19-15(22)13-9-5-4-8-12(13)14(21)16(23)20-18(17(24)25-2)10-6-3-7-11-18/h4-5,8-9H,3,6-7,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | PNUGJIMBOJJCHW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|