About methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate
methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 95278927) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate |
| PubChem CID | 95278927 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)[C@H]2C[C@@H]2c2ccccc2OC)CCCCC1 |
| InChI | InChI=1S/C19H25NO4/c1-23-16-9-5-4-8-13(16)14-12-15(14)17(21)20-19(18(22)24-2)10-6-3-7-11-19/h4-5,8-9,14-15H,3,6-7,10-12H2,1-2H3,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | XVGJOUPRSOFOJR-CABCVRRESA-N |
| XLogP | 2.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate (CID 95278927) is methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate is COC(=O)C1(NC(=O)[C@H]2C[C@@H]2c2ccccc2OC)CCCCC1.
What is the InChIKey of methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate?
The InChIKey is XVGJOUPRSOFOJR-CABCVRRESA-N. The full InChI is InChI=1S/C19H25NO4/c1-23-16-9-5-4-8-13(16)14-12-15(14)17(21)20-19(18(22)24-2)10-6-3-7-11-19/h4-5,8-9,14-15H,3,6-7,10-12H2,1-2H3,(H,20,21)/t14-,15+/m1/s1.
What are the key properties of methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate?
methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate has a molecular weight of 331.41 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(1S,2S)-2-(2-methoxyphenyl)cyclopropanecarbonyl]amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 95278927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).