About 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid
1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 124700304) has the molecular formula C16H16F3NO3
and a molecular weight of 327.30 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid |
| PubChem CID | 124700304 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC1)[C@H]1C[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO3/c17-16(18,19)12-5-2-1-4-9(12)10-8-11(10)13(21)20-15(14(22)23)6-3-7-15/h1-2,4-5,10-11H,3,6-8H2,(H,20,21)(H,22,23)/t10-,11-/m0/s1 |
| InChIKey | PUTDOOJMJJQRCV-QWRGUYRKSA-N |
| XLogP | 2.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid (CID 124700304) is 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid is O=C(NC1(C(=O)O)CCC1)[C@H]1C[C@H]1c1ccccc1C(F)(F)F.
What is the InChIKey of 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid?
The InChIKey is PUTDOOJMJJQRCV-QWRGUYRKSA-N. The full InChI is InChI=1S/C16H16F3NO3/c17-16(18,19)12-5-2-1-4-9(12)10-8-11(10)13(21)20-15(14(22)23)6-3-7-15/h1-2,4-5,10-11H,3,6-8H2,(H,20,21)(H,22,23)/t10-,11-/m0/s1.
What are the key properties of 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid?
1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid has a molecular weight of 327.30 g/mol, XLogP of 2.93, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 124700304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).