C20H32N4O3S — CID 9149845
4-ethoxy-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 9149845) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-ethoxy-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9149845 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-ethoxy-N-[(2S)-3-methyl-1-[2-(3-methylbutylcarbamothioyl)hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)N[C@H](C(=O)NNC(=S)NCCC(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C20H32N4O3S/c1-6-27-16-9-7-15(8-10-16)18(25)22-17(14(4)5)19(26)23-24-20(28)21-12-11-13(2)3/h7-10,13-14,17H,6,11-12H2,1-5H3,(H,22,25)(H,23,26)(H2,21,24,28)/t17-/m0/s1 |
| InChIKey | NBHNWAXTFFGDLE-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|