C15H19Cl2NO3 — CID 7848170
[(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-methylpentanoate (PubChem CID 7848170) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-methylpentanoate.
| Compound Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 7848170 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[C@@H](C)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO3/c1-9(2)4-7-14(19)21-10(3)15(20)18-13-8-11(16)5-6-12(13)17/h5-6,8-10H,4,7H2,1-3H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | BVWVACRYNXXSQE-JTQLQIEISA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |