C18H18FN3O7S — CID 46812039
[1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-(4-sulfamoylphenyl)propanoate (PubChem CID 46812039) has the molecular formula C18H18FN3O7S and a molecular weight of 439.42 g/mol. Its IUPAC name is [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-(4-sulfamoylphenyl)propanoate.
| Compound Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-(4-sulfamoylphenyl)propanoate |
|---|---|
| PubChem CID | 46812039 |
| Molecular Formula | C18H18FN3O7S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-(4-sulfamoylphenyl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18FN3O7S/c1-11(18(24)21-13-5-8-15(19)16(10-13)22(25)26)29-17(23)9-4-12-2-6-14(7-3-12)30(20,27)28/h2-3,5-8,10-11H,4,9H2,1H3,(H,21,24)(H2,20,27,28) |
| InChIKey | VZQWKFFARZLHAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|