C18H14FN3O6 — CID 9275899
[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenoxy)acetate (PubChem CID 9275899) has the molecular formula C18H14FN3O6 and a molecular weight of 387.32 g/mol. Its IUPAC name is [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9275899 |
| Molecular Formula | C18H14FN3O6 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccccc1C#N)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14FN3O6/c1-11(18(24)21-13-6-7-14(19)15(8-13)22(25)26)28-17(23)10-27-16-5-3-2-4-12(16)9-20/h2-8,11H,10H2,1H3,(H,21,24)/t11-/m0/s1 |
| InChIKey | BHKRBGAJOMYDOL-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|