C19H15F3N2O4 — CID 9318424
[(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenoxy)acetate (PubChem CID 9318424) has the molecular formula C19H15F3N2O4 and a molecular weight of 392.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9318424 |
| Molecular Formula | C19H15F3N2O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 2-(2-cyanophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccccc1C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O4/c1-12(18(26)24-15-7-4-6-14(9-15)19(20,21)22)28-17(25)11-27-16-8-3-2-5-13(16)10-23/h2-9,12H,11H2,1H3,(H,24,26)/t12-/m0/s1 |
| InChIKey | VNAJQBCIMFTYIA-LBPRGKRZSA-N |
| XLogP | 3.53 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |