C17H16F3NO2 — CID 1254376
(2R)-2-(2-methylphenoxy)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 1254376) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2R)-2-(2-methylphenoxy)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-(2-methylphenoxy)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 1254376 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R)-2-(2-methylphenoxy)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccccc1O[C@H](C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO2/c1-11-6-3-4-9-15(11)23-12(2)16(22)21-14-8-5-7-13(10-14)17(18,19)20/h3-10,12H,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | IMTCCLIUMKZZPR-GFCCVEGCSA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |