C15H12F3N3O4 — CID 16959128
2-[(2-nitro-3-pyridinyl)oxy]-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 16959128) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[(2-nitro-3-pyridinyl)oxy]-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(2-nitro-3-pyridinyl)oxy]-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16959128 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[(2-nitro-3-pyridinyl)oxy]-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Oc1cccnc1[N+](=O)[O-])C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N3O4/c1-9(25-12-6-3-7-19-13(12)21(23)24)14(22)20-11-5-2-4-10(8-11)15(16,17)18/h2-9H,1H3,(H,20,22) |
| InChIKey | OHGQUOFTYHIWND-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|