C21H15F3N4O5 — CID 29338744
3-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 29338744) has the molecular formula C21H15F3N4O5 and a molecular weight of 460.37 g/mol. Its IUPAC name is 3-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 29338744 |
| Molecular Formula | C21H15F3N4O5 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H15F3N4O5/c22-21(23,24)14-5-2-7-16(11-14)27-20(30)13-4-1-6-15(10-13)26-18(29)12-33-17-8-3-9-25-19(17)28(31)32/h1-11H,12H2,(H,26,29)(H,27,30) |
| InChIKey | JIFYBIRGSCNPOB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|