C22H20N4O6 — CID 16959110
N-(4-ethoxyphenyl)-4-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]benzamide (PubChem CID 16959110) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16959110 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[2-[(2-nitro-3-pyridinyl)oxy]acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)COc3cccnc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H20N4O6/c1-2-31-18-11-9-17(10-12-18)25-22(28)15-5-7-16(8-6-15)24-20(27)14-32-19-4-3-13-23-21(19)26(29)30/h3-13H,2,14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | YFZBUNZCBYAJCP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|