C15H18N2O3 — CID 67614674
1-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)hydrazine (PubChem CID 67614674) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)hydrazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)hydrazine |
|---|---|
| PubChem CID | 67614674 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)hydrazine |
| SMILES | COc1ccc(NNc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C15H18N2O3/c1-18-13-7-4-11(5-8-13)16-17-12-6-9-14(19-2)15(10-12)20-3/h4-10,16-17H,1-3H3 |
| InChIKey | NZSMVQKQVSMJPC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|