C15H15NO5 — CID 103606001
N-(3,4-dimethoxyphenyl)-2,4-dihydroxybenzamide (PubChem CID 103606001) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103606001 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2,4-dihydroxybenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(O)cc2O)cc1OC |
| InChI | InChI=1S/C15H15NO5/c1-20-13-6-3-9(7-14(13)21-2)16-15(19)11-5-4-10(17)8-12(11)18/h3-8,17-18H,1-2H3,(H,16,19) |
| InChIKey | HFZKWKNJIZNQGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |