C26H35N3O6 — CID 122530700
[(4S)-6,6-dimethyl-4,5-bis(phenylmethoxycarbonylamino)heptyl]carbamic acid (PubChem CID 122530700) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is [(4S)-6,6-dimethyl-4,5-bis(phenylmethoxycarbonylamino)heptyl]carbamic acid.
| Compound Name | [(4S)-6,6-dimethyl-4,5-bis(phenylmethoxycarbonylamino)heptyl]carbamic acid |
|---|---|
| PubChem CID | 122530700 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [(4S)-6,6-dimethyl-4,5-bis(phenylmethoxycarbonylamino)heptyl]carbamic acid |
| SMILES | CC(C)(C)C(NC(=O)OCc1ccccc1)[C@H](CCCNC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35N3O6/c1-26(2,3)22(29-25(33)35-18-20-13-8-5-9-14-20)21(15-10-16-27-23(30)31)28-24(32)34-17-19-11-6-4-7-12-19/h4-9,11-14,21-22,27H,10,15-18H2,1-3H3,(H,28,32)(H,29,33)(H,30,31)/t21-,22?/m0/s1 |
| InChIKey | YWBMTPJJCNDXJH-HMTLIYDFSA-N |
| XLogP | 4.67 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|