C20H29N3O10 — CID 129055872
(2,5-dioxopyrrolidin-1-yl) 7-(2,5-dioxopyrrolidin-1-yl)oxy-7-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate (PubChem CID 129055872) has the molecular formula C20H29N3O10 and a molecular weight of 471.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-(2,5-dioxopyrrolidin-1-yl)oxy-7-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-(2,5-dioxopyrrolidin-1-yl)oxy-7-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
|---|---|
| PubChem CID | 129055872 |
| Molecular Formula | C20H29N3O10 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-(2,5-dioxopyrrolidin-1-yl)oxy-7-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)ON1C(=O)CCC1=O)CCC(O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H29N3O10/c1-20(2,3)31-19(30)21-12(4-10-17(28)32-22-13(24)6-7-14(22)25)5-11-18(29)33-23-15(26)8-9-16(23)27/h12,17,28H,4-11H2,1-3H3,(H,21,30) |
| InChIKey | GPXZVIJRGPOFEA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|