C24H40N6O8 — CID 58858897
(2,5-dioxopyrrolidin-1-yl) 5-[1-[[3-[[(5S)-6-amino-6-oxo-5-(2-oxopropylamino)hexyl]amino]-2-oxobutyl]amino]ethylamino]-5-oxopentanoate (PubChem CID 58858897) has the molecular formula C24H40N6O8 and a molecular weight of 540.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[1-[[3-[[(5S)-6-amino-6-oxo-5-(2-oxopropylamino)hexyl]amino]-2-oxobutyl]amino]ethylamino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[1-[[3-[[(5S)-6-amino-6-oxo-5-(2-oxopropylamino)hexyl]amino]-2-oxobutyl]amino]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 58858897 |
| Molecular Formula | C24H40N6O8 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[1-[[3-[[(5S)-6-amino-6-oxo-5-(2-oxopropylamino)hexyl]amino]-2-oxobutyl]amino]ethylamino]-5-oxopentanoate |
| SMILES | CC(=O)CN[C@@H](CCCCNC(C)C(=O)CNC(C)NC(=O)CCCC(=O)ON1C(=O)CCC1=O)C(N)=O |
| InChI | InChI=1S/C24H40N6O8/c1-15(31)13-28-18(24(25)37)7-4-5-12-26-16(2)19(32)14-27-17(3)29-20(33)8-6-9-23(36)38-30-21(34)10-11-22(30)35/h16-18,26-28H,4-14H2,1-3H3,(H2,25,37)(H,29,33)/t16?,17?,18-/m0/s1 |
| InChIKey | OWXPVDUCTWJVGH-ABHNRTSZSA-N |
| XLogP | -1.43 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|