C25H51N2O4Si2+ — CID 163761396
butyl-[3-[dimethyl(silyloxy)silyl]propyl]-[6-(2-methylidene-5-oxopyrrolidin-1-yl)oxy-6-oxohexyl]-pentylazanium (PubChem CID 163761396) has the molecular formula C25H51N2O4Si2+ and a molecular weight of 499.87 g/mol. Its IUPAC name is butyl-[3-[dimethyl(silyloxy)silyl]propyl]-[6-(2-methylidene-5-oxopyrrolidin-1-yl)oxy-6-oxohexyl]-pentylazanium.
| Compound Name | butyl-[3-[dimethyl(silyloxy)silyl]propyl]-[6-(2-methylidene-5-oxopyrrolidin-1-yl)oxy-6-oxohexyl]-pentylazanium |
|---|---|
| PubChem CID | 163761396 |
| Molecular Formula | C25H51N2O4Si2+ |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | butyl-[3-[dimethyl(silyloxy)silyl]propyl]-[6-(2-methylidene-5-oxopyrrolidin-1-yl)oxy-6-oxohexyl]-pentylazanium |
| SMILES | C=C1CCC(=O)N1OC(=O)CCCCC[N+](CCCC)(CCCCC)CCC[Si](C)(C)O[SiH3] |
| InChI | InChI=1S/C25H51N2O4Si2/c1-6-8-12-19-27(18-9-7-2,21-14-22-33(4,5)31-32)20-13-10-11-15-25(29)30-26-23(3)16-17-24(26)28/h3,6-22H2,1-2,4-5,32H3/q+1 |
| InChIKey | APBOKCTUXBFVFI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|