C20H21NO6 — CID 14858797
2-[2-[4-(4-carboxybutanoylamino)phenyl]-1-hydroxyethyl]benzoic acid (PubChem CID 14858797) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[2-[4-(4-carboxybutanoylamino)phenyl]-1-hydroxyethyl]benzoic acid.
| Compound Name | 2-[2-[4-(4-carboxybutanoylamino)phenyl]-1-hydroxyethyl]benzoic acid |
|---|---|
| PubChem CID | 14858797 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[2-[4-(4-carboxybutanoylamino)phenyl]-1-hydroxyethyl]benzoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(CC(O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO6/c22-17(15-4-1-2-5-16(15)20(26)27)12-13-8-10-14(11-9-13)21-18(23)6-3-7-19(24)25/h1-2,4-5,8-11,17,22H,3,6-7,12H2,(H,21,23)(H,24,25)(H,26,27) |
| InChIKey | IUTVQACVRPFUBZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |