C36H30N4O12 — CID 18683956
2-[[2-[2-carboxy-N-[[4-(2-carboxyethyl)phenyl]carbamoyl]anilino]-2-oxoacetyl]-[[4-(2-carboxyethyl)phenyl]carbamoyl]amino]benzoic acid (PubChem CID 18683956) has the molecular formula C36H30N4O12 and a molecular weight of 710.65 g/mol. Its IUPAC name is 2-[[2-[2-carboxy-N-[[4-(2-carboxyethyl)phenyl]carbamoyl]anilino]-2-oxoacetyl]-[[4-(2-carboxyethyl)phenyl]carbamoyl]amino]benzoic acid.
| Compound Name | 2-[[2-[2-carboxy-N-[[4-(2-carboxyethyl)phenyl]carbamoyl]anilino]-2-oxoacetyl]-[[4-(2-carboxyethyl)phenyl]carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18683956 |
| Molecular Formula | C36H30N4O12 |
| Molecular Weight | 710.65 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | 2-[[2-[2-carboxy-N-[[4-(2-carboxyethyl)phenyl]carbamoyl]anilino]-2-oxoacetyl]-[[4-(2-carboxyethyl)phenyl]carbamoyl]amino]benzoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)N(C(=O)C(=O)N(C(=O)Nc2ccc(CCC(=O)O)cc2)c2ccccc2C(=O)O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C36H30N4O12/c41-29(42)19-13-21-9-15-23(16-10-21)37-35(51)39(27-7-3-1-5-25(27)33(47)48)31(45)32(46)40(28-8-4-2-6-26(28)34(49)50)36(52)38-24-17-11-22(12-18-24)14-20-30(43)44/h1-12,15-18H,13-14,19-20H2,(H,37,51)(H,38,52)(H,41,42)(H,43,44)(H,47,48)(H,49,50) |
| InChIKey | VMMPZGYSIRXZAD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 248.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|