C26H32N6O8 — CID 170019629
4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-1-[[2-oxo-2-(3-oxopropylamino)ethyl]amino]-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]butanamide (PubChem CID 170019629) has the molecular formula C26H32N6O8 and a molecular weight of 556.58 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-1-[[2-oxo-2-(3-oxopropylamino)ethyl]amino]-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-1-[[2-oxo-2-(3-oxopropylamino)ethyl]amino]-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 170019629 |
| Molecular Formula | C26H32N6O8 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-1-[[2-oxo-2-(3-oxopropylamino)ethyl]amino]-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]butanamide |
| SMILES | O=CCCNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H32N6O8/c33-13-5-11-27-21(35)16-30-26(40)19(14-18-6-2-1-3-7-18)31-23(37)17-29-22(36)15-28-20(34)8-4-12-32-24(38)9-10-25(32)39/h1-3,6-7,9-10,13,19H,4-5,8,11-12,14-17H2,(H,27,35)(H,28,34)(H,29,36)(H,30,40)(H,31,37)/t19-/m0/s1 |
| InChIKey | VAWWADVDMHYVLC-IBGZPJMESA-N |
| XLogP | -2.53 |
| TPSA | 199.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|