C31H42N6O9 — CID 170090614
[2-[[1-[[2-[(3-aminocyclobutyl)methoxymethylamino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetate (PubChem CID 170090614) has the molecular formula C31H42N6O9 and a molecular weight of 642.71 g/mol. Its IUPAC name is [2-[[1-[[2-[(3-aminocyclobutyl)methoxymethylamino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetate.
| Compound Name | [2-[[1-[[2-[(3-aminocyclobutyl)methoxymethylamino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetate |
|---|---|
| PubChem CID | 170090614 |
| Molecular Formula | C31H42N6O9 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | [2-[[1-[[2-[(3-aminocyclobutyl)methoxymethylamino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetate |
| SMILES | NC1CC(COCNC(=O)CNC(=O)C(Cc2ccccc2)NC(=O)COC(=O)CNC(=O)CCCCCN2C(=O)C=CC2=O)C1 |
| InChI | InChI=1S/C31H42N6O9/c32-23-13-22(14-23)18-45-20-35-26(39)16-34-31(44)24(15-21-7-3-1-4-8-21)36-27(40)19-46-30(43)17-33-25(38)9-5-2-6-12-37-28(41)10-11-29(37)42/h1,3-4,7-8,10-11,22-24H,2,5-6,9,12-20,32H2,(H,33,38)(H,34,44)(H,35,39)(H,36,40) |
| InChIKey | AZCVWMDDWWMEFI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 215.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|