C31H44N6O11 — CID 174223868
(2S)-2-[[2-[[2-[3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(ethoxymethylamino)-2-oxoethyl]-3-phenylpropanamide (PubChem CID 174223868) has the molecular formula C31H44N6O11 and a molecular weight of 676.72 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-[3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(ethoxymethylamino)-2-oxoethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[[2-[3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(ethoxymethylamino)-2-oxoethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 174223868 |
| Molecular Formula | C31H44N6O11 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | (2S)-2-[[2-[[2-[3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(ethoxymethylamino)-2-oxoethyl]-3-phenylpropanamide |
| SMILES | CCOCNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCOCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H44N6O11/c1-2-45-22-35-27(40)20-34-31(44)24(18-23-6-4-3-5-7-23)36-28(41)21-33-26(39)19-32-25(38)10-12-46-14-16-48-17-15-47-13-11-37-29(42)8-9-30(37)43/h3-9,24H,2,10-22H2,1H3,(H,32,38)(H,33,39)(H,34,44)(H,35,40)(H,36,41)/t24-/m0/s1 |
| InChIKey | GTVSOBXBJIRMCU-DEOSSOPVSA-N |
| XLogP | -2.46 |
| TPSA | 219.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|