C40H45N7O10 — CID 159800981
[4-[[(2R,5S)-2-[3-(diaminomethylideneamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxo-6-phenylhexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 159800981) has the molecular formula C40H45N7O10 and a molecular weight of 783.84 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-[3-(diaminomethylideneamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxo-6-phenylhexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2R,5S)-2-[3-(diaminomethylideneamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxo-6-phenylhexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 159800981 |
| Molecular Formula | C40H45N7O10 |
| Molecular Weight | 783.84 g/mol |
| Exact Mass | 783.32 |
| IUPAC Name | [4-[[(2R,5S)-2-[3-(diaminomethylideneamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxo-6-phenylhexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | NC(N)=NCCCC(CC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C40H45N7O10/c41-39(42)43-22-7-10-29(38(52)44-30-14-12-28(13-15-30)26-56-40(53)57-32-18-16-31(17-19-32)47(54)55)25-34(48)33(24-27-8-3-1-4-9-27)45-35(49)11-5-2-6-23-46-36(50)20-21-37(46)51/h1,3-4,8-9,12-21,29,33H,2,5-7,10-11,22-26H2,(H,44,52)(H,45,49)(H4,41,42,43)/t29?,33-/m0/s1 |
| InChIKey | YWPXECZHXKQGBQ-CJEZNJPTSA-N |
| XLogP | 4.09 |
| TPSA | 255.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|