C30H37N3O10 — CID 159044777
(4-nitrophenyl) [4-[[(2S)-2-[[(2S)-4-oxo-6-(3-oxobutoxy)-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl carbonate (PubChem CID 159044777) has the molecular formula C30H37N3O10 and a molecular weight of 599.64 g/mol. Its IUPAC name is (4-nitrophenyl) [4-[[(2S)-2-[[(2S)-4-oxo-6-(3-oxobutoxy)-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl carbonate.
| Compound Name | (4-nitrophenyl) [4-[[(2S)-2-[[(2S)-4-oxo-6-(3-oxobutoxy)-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl carbonate |
|---|---|
| PubChem CID | 159044777 |
| Molecular Formula | C30H37N3O10 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (4-nitrophenyl) [4-[[(2S)-2-[[(2S)-4-oxo-6-(3-oxobutoxy)-2-propan-2-ylhexanoyl]amino]propanoyl]amino]phenyl]methyl carbonate |
| SMILES | CC(=O)CCOCCC(=O)C[C@H](C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)C(C)C |
| InChI | InChI=1S/C30H37N3O10/c1-19(2)27(17-25(35)14-16-41-15-13-20(3)34)29(37)31-21(4)28(36)32-23-7-5-22(6-8-23)18-42-30(38)43-26-11-9-24(10-12-26)33(39)40/h5-12,19,21,27H,13-18H2,1-4H3,(H,31,37)(H,32,36)/t21-,27-/m0/s1 |
| InChIKey | JWNATVZAAXLESK-IDISGSTGSA-N |
| XLogP | 4.37 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|