C32H39N5O11 — CID 131981793
1-[4-[[(2S)-3-methyl-1-[[(2S)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxylic acid (PubChem CID 131981793) has the molecular formula C32H39N5O11 and a molecular weight of 669.69 g/mol. Its IUPAC name is 1-[4-[[(2S)-3-methyl-1-[[(2S)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[[(2S)-3-methyl-1-[[(2S)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 131981793 |
| Molecular Formula | C32H39N5O11 |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | 1-[4-[[(2S)-3-methyl-1-[[(2S)-1-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)CCC(=O)N1CCC(C(=O)O)CC1)C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C32H39N5O11/c1-19(2)28(35-26(38)12-13-27(39)36-16-14-22(15-17-36)31(42)43)30(41)33-20(3)29(40)34-23-6-4-21(5-7-23)18-47-32(44)48-25-10-8-24(9-11-25)37(45)46/h4-11,19-20,22,28H,12-18H2,1-3H3,(H,33,41)(H,34,40)(H,35,38)(H,42,43)/t20-,28-/m0/s1 |
| InChIKey | CSRFOLONUMQNBS-MMTVBGGISA-N |
| XLogP | 3.00 |
| TPSA | 223.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|