C29H29N3O10 — CID 157277344
[4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 157277344) has the molecular formula C29H29N3O10 and a molecular weight of 579.56 g/mol. Its IUPAC name is [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 157277344 |
| Molecular Formula | C29H29N3O10 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | C[C@H](CC(=O)CCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)Cc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H29N3O10/c1-18(15-23(33)13-14-31-26(35)11-12-27(31)36)28(37)30-19(2)25(34)16-20-3-5-21(6-4-20)17-41-29(38)42-24-9-7-22(8-10-24)32(39)40/h3-12,18-19H,13-17H2,1-2H3,(H,30,37)/t18-,19+/m1/s1 |
| InChIKey | AISXOZVIROGHBV-MOPGFXCFSA-N |
| XLogP | 2.84 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|