C30H31N3O9 — CID 159270762
[4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl 2-(4-nitrophenyl)acetate (PubChem CID 159270762) has the molecular formula C30H31N3O9 and a molecular weight of 577.59 g/mol. Its IUPAC name is [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl 2-(4-nitrophenyl)acetate.
| Compound Name | [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl 2-(4-nitrophenyl)acetate |
|---|---|
| PubChem CID | 159270762 |
| Molecular Formula | C30H31N3O9 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [4-[(3S)-3-[[(2R)-6-(2,5-dioxopyrrol-1-yl)-2-methyl-4-oxohexanoyl]amino]-2-oxobutyl]phenyl]methyl 2-(4-nitrophenyl)acetate |
| SMILES | C[C@H](CC(=O)CCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)Cc1ccc(COC(=O)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H31N3O9/c1-19(15-25(34)13-14-32-27(36)11-12-28(32)37)30(39)31-20(2)26(35)16-21-3-5-23(6-4-21)18-42-29(38)17-22-7-9-24(10-8-22)33(40)41/h3-12,19-20H,13-18H2,1-2H3,(H,31,39)/t19-,20+/m1/s1 |
| InChIKey | UYSAPFAMACGNMM-UXHICEINSA-N |
| XLogP | 2.41 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|