C27H35N5O9 — CID 168747554
3-[2-(2-aminopropanoylamino)propanoylamino]-4-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl]anilino]-4-oxobutanoic acid (PubChem CID 168747554) has the molecular formula C27H35N5O9 and a molecular weight of 573.60 g/mol. Its IUPAC name is 3-[2-(2-aminopropanoylamino)propanoylamino]-4-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl]anilino]-4-oxobutanoic acid.
| Compound Name | 3-[2-(2-aminopropanoylamino)propanoylamino]-4-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 168747554 |
| Molecular Formula | C27H35N5O9 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 3-[2-(2-aminopropanoylamino)propanoylamino]-4-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl]anilino]-4-oxobutanoic acid |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)Nc1ccc(COC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C27H35N5O9/c1-16(28)25(38)29-17(2)26(39)31-20(14-23(35)36)27(40)30-19-9-7-18(8-10-19)15-41-24(37)6-4-3-5-13-32-21(33)11-12-22(32)34/h7-12,16-17,20H,3-6,13-15,28H2,1-2H3,(H,29,38)(H,30,40)(H,31,39)(H,35,36) |
| InChIKey | GTMSQDMWVAALCM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 214.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|