C32H43N7O10 — CID 168747573
prop-2-enyl N-[1-[[1-[[4-amino-1-[4-[6-(2,5-dioxopyrrol-1-yl)hexylcarbamoyloxymethyl]anilino]-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 168747573) has the molecular formula C32H43N7O10 and a molecular weight of 685.74 g/mol. Its IUPAC name is prop-2-enyl N-[1-[[1-[[4-amino-1-[4-[6-(2,5-dioxopyrrol-1-yl)hexylcarbamoyloxymethyl]anilino]-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[[1-[[4-amino-1-[4-[6-(2,5-dioxopyrrol-1-yl)hexylcarbamoyloxymethyl]anilino]-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 168747573 |
| Molecular Formula | C32H43N7O10 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | prop-2-enyl N-[1-[[1-[[4-amino-1-[4-[6-(2,5-dioxopyrrol-1-yl)hexylcarbamoyloxymethyl]anilino]-1,4-dioxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C=CCOC(=O)NC(C)C(=O)NC(C)C(=O)NC(CC(N)=O)C(=O)Nc1ccc(COC(=O)NCCCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C32H43N7O10/c1-4-17-48-32(47)36-21(3)28(43)35-20(2)29(44)38-24(18-25(33)40)30(45)37-23-11-9-22(10-12-23)19-49-31(46)34-15-7-5-6-8-16-39-26(41)13-14-27(39)42/h4,9-14,20-21,24H,1,5-8,15-19H2,2-3H3,(H2,33,40)(H,34,46)(H,35,43)(H,36,47)(H,37,45)(H,38,44) |
| InChIKey | MUQWZUROINTPCE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 244.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|