C28H34N2O10Si — CID 171109590
[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy-di(propan-2-yl)silyl]oxyphenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 171109590) has the molecular formula C28H34N2O10Si and a molecular weight of 586.67 g/mol. Its IUPAC name is [4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy-di(propan-2-yl)silyl]oxyphenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy-di(propan-2-yl)silyl]oxyphenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 171109590 |
| Molecular Formula | C28H34N2O10Si |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [4-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy-di(propan-2-yl)silyl]oxyphenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[Si](OCCOCCN1C(=O)C=CC1=O)(Oc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)C(C)C |
| InChI | InChI=1S/C28H34N2O10Si/c1-20(2)41(21(3)4,38-18-17-36-16-15-29-26(31)13-14-27(29)32)40-25-9-5-22(6-10-25)19-37-28(33)39-24-11-7-23(8-12-24)30(34)35/h5-14,20-21H,15-19H2,1-4H3 |
| InChIKey | CMVRTMAPIWZLLP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 143.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|