C18H18N2O9 — CID 90205221
6-(2,5-dioxopyrrol-1-yl)-4-[(4-nitrophenoxy)carbonyloxymethyl]hexanoic acid (PubChem CID 90205221) has the molecular formula C18H18N2O9 and a molecular weight of 406.35 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-4-[(4-nitrophenoxy)carbonyloxymethyl]hexanoic acid.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-4-[(4-nitrophenoxy)carbonyloxymethyl]hexanoic acid |
|---|---|
| PubChem CID | 90205221 |
| Molecular Formula | C18H18N2O9 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-4-[(4-nitrophenoxy)carbonyloxymethyl]hexanoic acid |
| SMILES | O=C(O)CCC(CCN1C(=O)C=CC1=O)COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O9/c21-15-6-7-16(22)19(15)10-9-12(1-8-17(23)24)11-28-18(25)29-14-4-2-13(3-5-14)20(26)27/h2-7,12H,1,8-11H2,(H,23,24) |
| InChIKey | DXJPPVWMEDGYCG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|