C27H37F3N4O6 — CID 176555943
6-(2,5-dioxopyrrol-1-yl)-N-[1-[[2-[4-(hydroxymethyl)-2-(trifluoromethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]hexanamide;ethane (PubChem CID 176555943) has the molecular formula C27H37F3N4O6 and a molecular weight of 570.61 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[1-[[2-[4-(hydroxymethyl)-2-(trifluoromethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]hexanamide;ethane.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[1-[[2-[4-(hydroxymethyl)-2-(trifluoromethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]hexanamide;ethane |
|---|---|
| PubChem CID | 176555943 |
| Molecular Formula | C27H37F3N4O6 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[1-[[2-[4-(hydroxymethyl)-2-(trifluoromethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]hexanamide;ethane |
| SMILES | CC.CC(C)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NCC(=O)Nc1ccc(CO)cc1C(F)(F)F |
| InChI | InChI=1S/C25H31F3N4O6.C2H6/c1-15(2)23(31-19(34)6-4-3-5-11-32-21(36)9-10-22(32)37)24(38)29-13-20(35)30-18-8-7-16(14-33)12-17(18)25(26,27)28;1-2/h7-10,12,15,23,33H,3-6,11,13-14H2,1-2H3,(H,29,38)(H,30,35)(H,31,34);1-2H3 |
| InChIKey | PBFHGWUIHIKCPX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|