C28H41N7O6 — CID 170898534
N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 170898534) has the molecular formula C28H41N7O6 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 170898534 |
| Molecular Formula | C28H41N7O6 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C28H41N7O6/c1-18(2)25(34-22(37)8-4-3-5-16-35-23(38)13-14-24(35)39)27(41)33-21(7-6-15-31-28(29)30)26(40)32-20-11-9-19(17-36)10-12-20/h9-14,18,21,25,36H,3-8,15-17H2,1-2H3,(H,32,40)(H,33,41)(H,34,37)(H4,29,30,31)/t21-,25-/m0/s1 |
| InChIKey | PZRALCAFBWLJEC-OFVILXPXSA-N |
| XLogP | 0.28 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|