C21H28NO5- — CID 7226930
4-[[4-(4-tert-butylcyclohexyl)oxy-4-oxobutanoyl]amino]benzoate (PubChem CID 7226930) has the molecular formula C21H28NO5- and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-[[4-(4-tert-butylcyclohexyl)oxy-4-oxobutanoyl]amino]benzoate.
| Compound Name | 4-[[4-(4-tert-butylcyclohexyl)oxy-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 7226930 |
| Molecular Formula | C21H28NO5- |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[[4-(4-tert-butylcyclohexyl)oxy-4-oxobutanoyl]amino]benzoate |
| SMILES | CC(C)(C)C1CCC(OC(=O)CCC(=O)Nc2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H29NO5/c1-21(2,3)15-6-10-17(11-7-15)27-19(24)13-12-18(23)22-16-8-4-14(5-9-16)20(25)26/h4-5,8-9,15,17H,6-7,10-13H2,1-3H3,(H,22,23)(H,25,26)/p-1 |
| InChIKey | CNBAHGIVARSBTD-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |