C17H13F3N2O4 — CID 2821532
[[amino(2,3-dihydro-1,4-benzodioxin-3-yl)methylidene]amino] 3-(trifluoromethyl)benzoate (PubChem CID 2821532) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is [[amino(2,3-dihydro-1,4-benzodioxin-3-yl)methylidene]amino] 3-(trifluoromethyl)benzoate.
| Compound Name | [[amino(2,3-dihydro-1,4-benzodioxin-3-yl)methylidene]amino] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2821532 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [[amino(2,3-dihydro-1,4-benzodioxin-3-yl)methylidene]amino] 3-(trifluoromethyl)benzoate |
| SMILES | NC(=NOC(=O)c1cccc(C(F)(F)F)c1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C17H13F3N2O4/c18-17(19,20)11-5-3-4-10(8-11)16(23)26-22-15(21)14-9-24-12-6-1-2-7-13(12)25-14/h1-8,14H,9H2,(H2,21,22) |
| InChIKey | WPFQXLCVBZHMES-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|