C16H13Cl2N3O4 — CID 7210231
[[amino-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylidene]amino] N-(2,4-dichlorophenyl)carbamate (PubChem CID 7210231) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is [[amino-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylidene]amino] N-(2,4-dichlorophenyl)carbamate.
| Compound Name | [[amino-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylidene]amino] N-(2,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 7210231 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | [[amino-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methylidene]amino] N-(2,4-dichlorophenyl)carbamate |
| SMILES | NC(=NOC(=O)Nc1ccc(Cl)cc1Cl)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H13Cl2N3O4/c17-9-5-6-11(10(18)7-9)20-16(22)25-21-15(19)14-8-23-12-3-1-2-4-13(12)24-14/h1-7,14H,8H2,(H2,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | UQOGTXBGQDHFMY-AWEZNQCLSA-N |
| XLogP | 3.65 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|