C19H14FNO5 — CID 9080377
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 9080377) has the molecular formula C19H14FNO5 and a molecular weight of 355.32 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 9080377 |
| Molecular Formula | C19H14FNO5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)NCc1ccccc1F |
| InChI | InChI=1S/C19H14FNO5/c20-14-7-3-1-5-12(14)10-21-18(23)11-25-19(24)17-9-15(22)13-6-2-4-8-16(13)26-17/h1-9H,10-11H2,(H,21,23) |
| InChIKey | HHMHWYLKOJSUFM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |