C21H22N2O5S — CID 25443449
N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-oxochromene-2-carboxamide (PubChem CID 25443449) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 25443449 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-4-oxochromene-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cc(=O)c3ccccc3o2)ccc1C |
| InChI | InChI=1S/C21H22N2O5S/c1-4-23(5-2)29(26,27)20-12-15(11-10-14(20)3)22-21(25)19-13-17(24)16-8-6-7-9-18(16)28-19/h6-13H,4-5H2,1-3H3,(H,22,25) |
| InChIKey | VEWIHIREUODTOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |