C16H22Cl2N4O5S — CID 119432907
5-methoxy-N-[3-(methylamino)propyl]-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride (PubChem CID 119432907) has the molecular formula C16H22Cl2N4O5S and a molecular weight of 453.35 g/mol. Its IUPAC name is 5-methoxy-N-[3-(methylamino)propyl]-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride.
| Compound Name | 5-methoxy-N-[3-(methylamino)propyl]-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119432907 |
| Molecular Formula | C16H22Cl2N4O5S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-methoxy-N-[3-(methylamino)propyl]-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1cc(OC)c(OCc2cscn2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C16H20N4O5S.2ClH/c1-17-4-3-5-18-16(21)12-6-14(24-2)15(7-13(12)20(22)23)25-8-11-9-26-10-19-11;;/h6-7,9-10,17H,3-5,8H2,1-2H3,(H,18,21);2*1H |
| InChIKey | RKYCBCOMNBNWLQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|