C17H22Cl2N4O5S — CID 119616375
N-(2-amino-1-cyclopropylethyl)-5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride (PubChem CID 119616375) has the molecular formula C17H22Cl2N4O5S and a molecular weight of 465.36 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119616375 |
| Molecular Formula | C17H22Cl2N4O5S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzamide;dihydrochloride |
| SMILES | COc1cc(C(=O)NC(CN)C2CC2)c([N+](=O)[O-])cc1OCc1cscn1.Cl.Cl |
| InChI | InChI=1S/C17H20N4O5S.2ClH/c1-25-15-4-12(17(22)20-13(6-18)10-2-3-10)14(21(23)24)5-16(15)26-7-11-8-27-9-19-11;;/h4-5,8-10,13H,2-3,6-7,18H2,1H3,(H,20,22);2*1H |
| InChIKey | ZNQYCHQSCZJKPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|