C16H24ClN3O4 — CID 119591922
N-(2-amino-1-cyclohexylethyl)-2-methoxy-5-nitrobenzamide;hydrochloride (PubChem CID 119591922) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-methoxy-5-nitrobenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-methoxy-5-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119591922 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-methoxy-5-nitrobenzamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NC(CN)C1CCCCC1.Cl |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-23-15-8-7-12(19(21)22)9-13(15)16(20)18-14(10-17)11-5-3-2-4-6-11;/h7-9,11,14H,2-6,10,17H2,1H3,(H,18,20);1H |
| InChIKey | WKYLLPJHLWHQAJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|