C17H27ClN2O3 — CID 119591832
N-(2-amino-1-cyclohexylethyl)-2,3-dimethoxybenzamide;hydrochloride (PubChem CID 119591832) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2,3-dimethoxybenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2,3-dimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119591832 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2,3-dimethoxybenzamide;hydrochloride |
| SMILES | COc1cccc(C(=O)NC(CN)C2CCCCC2)c1OC.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-21-15-10-6-9-13(16(15)22-2)17(20)19-14(11-18)12-7-4-3-5-8-12;/h6,9-10,12,14H,3-5,7-8,11,18H2,1-2H3,(H,19,20);1H |
| InChIKey | APONVJFLTPKKNI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |